On Target NK1R_HUMAN 0.4375/CHEMBL56811
For the given ligand Ibuprofen, we have found in our database that, being scored 0.4375, the most similar ligand is CHEMBL56811. Check out the elaboration below.
| Ibuprofen (Given Ligand) | CHEMBL56811 (Similar Ligand) |
|---|---|
| CC(C)Cc1ccc(C(C)C(=O)O)cc1 | Cc1cc(C)cc(COCC(O)C(c2ccccc2)c3ccccc3)c1 |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000040 00000000 00000000 00000000 00000900 00080840 08100000 40009800 01008000 00000000 40040000 00080008 08000000 02000000 00000000 00000001 00000100 08000a00 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00002000 00000400 | 00000000 00000008 80000100 00010300 00000051 00004000 00000000 01000000 00000900 00080840 08100000 40008000 00000000 00010000 00040000 02081008 08000000 02000000 00400000 40000001 00000120 08000020 05000040 08400010 00000400 a0002000 00080000 40000020 00000280 00020002 40000004 02000400 |