On Target ACM4_HUMAN 0.5/CHEMBL2377392
For the given ligand Ibuprofen, we have found in our database that, being scored 0.5, the most similar ligand is CHEMBL2377392. Check out the elaboration below.
| Ibuprofen (Given Ligand) | CHEMBL2377392 (Similar Ligand) |
|---|---|
| CC(C)Cc1ccc(C(C)C(=O)O)cc1 | CC[C@H](C)C(C(=O)OCCCN(CC)CC)c1ccccc1 |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000040 00000000 00000000 00000000 00000900 00080840 08100000 40009800 01008000 00000000 40040000 00080008 08000000 02000000 00000000 00000001 00000100 08000a00 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00002000 00000400 | 00010040 01000000 00100102 00010700 00080040 00000000 00000000 00000040 00000800 00080840 08300000 40009000 05008002 00280000 40040000 00081008 08a20000 02000000 04c00000 00000201 00010120 18000a00 01000080 00400010 00000401 80000000 00000000 00000000 00000200 00060006 00002000 00000600 |