On Target EDNRA_HUMAN 0.3888889/CHEMBL290026
For the given ligand Ibuprofen, we have found in our database that, being scored 0.3888889, the most similar ligand is CHEMBL290026. Check out the elaboration below.
| Ibuprofen (Given Ligand) | CHEMBL290026 (Similar Ligand) |
|---|---|
| CC(C)Cc1ccc(C(C)C(=O)O)cc1 | COc1ccc(cc1)[C@H]2[C@@H]([C@@H](c3ccc(OC)cc3)c4ccccc24)C(=O)O |
|
|
|
|
|
|
| 00000000 00000000 00000100 00010200 00000040 00000000 00000000 00000000 00000900 00080840 08100000 40009800 01008000 00000000 40040000 00080008 08000000 02000000 00000000 00000001 00000100 08000a00 01000000 00400010 00000000 80000000 00000000 00000000 00000000 00020002 00002000 00000400 | 00000000 01000008 2000010a 00010200 00001000 00000002 03041400 01000001 00000800 00080840 08100000 40009000 04008002 00201000 01000001 000a0008 00000000 02000000 00500008 00020001 00000100 08000a00 01004040 00400010 00000800 a0000001 00120000 40000000 02000280 00020002 00000000 00000400 |