On Target AA3R_HUMAN 0.33333334/CHEMBL56
For the given ligand CBDA, we have found in our database that, being scored 0.33333334, the most similar ligand is CHEMBL56. Check out the elaboration below.
| CBDA (Given Ligand) | CHEMBL56 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)c(C(=O)O)c2O | CCCN(CCC)C1CCc2cccc(O)c2C1 |
|
|
|
|
|
|
| 00000001 43000808 20000103 00010202 00010001 4082c000 02000001 00000e02 00040900 00980a42 28100000 40408840 00028022 00200000 00000420 08082008 00000000 02100020 00202000 40020a01 00400500 08020a60 0100c000 00400014 00200000 80000201 04424200 80000000 00000002 00024002 e4020000 00010400 | 00000000 43000208 20100102 00010600 00000020 40000000 02000000 20000201 00000880 000808c0 08300000 408080c0 00000002 00200000 00000000 02042008 80000200 02000000 00002000 00020201 00000100 18200000 00004000 81400010 00000000 80000001 00000000 10000000 04000002 0006400a 00000000 00002600 |