On Target CXCR4_HUMAN 0.31690142/CHEMBL126657
For the given ligand HU-580, we have found in our database that, being scored 0.31690142, the most similar ligand is CHEMBL126657. Check out the elaboration below.
| HU-580 (Given Ligand) | CHEMBL126657 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)c(C(=O)OC)c2O | COc1cc(\C=C\C(=O)c2ccc(Cl)cc2)ccc1O |
|
|
|
|
|
|
| 00000001 43000808 20000103 00010202 00010001 4082c400 02000001 00000e02 00040900 00980a42 28100000 40408840 00028022 00210000 00000420 0a082008 00020800 02100020 00202000 40020a01 00400500 08020a60 0100c000 00400014 00200000 80002201 04424200 80000000 00000203 00024002 e4020004 00010400 | 00008000 40000808 20000308 00010200 00001000 00800000 82000081 00000400 01800000 00b80840 08000000 40108800 0200c026 00000000 01000003 00008008 00000400 02100000 00098000 00020a00 00000000 08020300 00008001 00400014 01002000 80000000 00462000 40000000 00400200 00020102 84000000 00020500 |