On Target TSHR_HUMAN 0.2763819/CHEMBL1589735
For the given ligand HU-580, we have found in our database that, being scored 0.2763819, the most similar ligand is CHEMBL1589735. Check out the elaboration below.
| HU-580 (Given Ligand) | CHEMBL1589735 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)c(C(=O)OC)c2O | COc1ccc(cc1COc2ccc(NC(=O)C)cc2)C3Nc4ccccc4C(=O)N3CCc5ccccc5 |
|
|
|
|
|
|
| 00000001 43000808 20000103 00010202 00010001 4082c400 02000001 00000e02 00040900 00980a42 28100000 40408840 00028022 00210000 00000420 0a082008 00020800 02100020 00202000 40020a01 00400500 08020a60 0100c000 00400014 00200000 80002201 04424200 80000000 00000203 00024002 e4020004 00010400 | 14004006 00801808 20100108 00010e00 00001001 40114042 12040004 0200380d 00800180 20080840 49280004 4000c000 00809822 00110000 01020441 02082008 00046808 03400022 08000000 40820a01 c0100100 18238620 20032000 81c4101c 00110000 c0002000 08260000 80001080 04008300 00060003 e0044004 c0004601 |