On Target CXCR1_HUMAN 0.26530612/CHEMBL518355
For the given ligand CBDA, we have found in our database that, being scored 0.26530612, the most similar ligand is CHEMBL518355. Check out the elaboration below.
| CBDA (Given Ligand) | CHEMBL518355 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)c(C(=O)O)c2O | CN(C)C(=O)c1cccc(Nc2nsnc2N[C@@H](c3ccc4CCCc4c3)C(C)(C)C)c1O |
|
|
|
|
|
|
| 00000001 43000808 20000103 00010202 00010001 4082c000 02000001 00000e02 00040900 00980a42 28100000 40408840 00028022 00200000 00000420 08082008 00000000 02100020 00202000 40020a01 00400500 08020a60 0100c000 00400014 00200000 80000201 04424200 80000000 00000002 00024002 e4020000 00010400 | 10010002 01010888 20100103 01010e20 20000001 08020010 12000010 0a101600 00803900 00080851 88352004 4000c880 8a008812 00301001 00040041 100e600c 00040000 1a005000 08000412 10024001 41100100 18228f00 21014010 00410015 00840002 80800480 28000000 80800090 20408108 10060003 c6041000 00010600 |