On Target NPY5R_HUMAN 0.39884394/CHEMBL469257
For the given ligand HU-580, we have found in our database that, being scored 0.39884394, the most similar ligand is CHEMBL469257. Check out the elaboration below.
| HU-580 (Given Ligand) | CHEMBL469257 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)c(C(=O)OC)c2O | CCc1ccc2C(C3=C(O)CC(C)(C)CC3=O)C4=C(CC(C)(C)CC4=O)Oc2c1 |
|
|
|
|
|
|
| 00000001 43000808 20000103 00010202 00010001 4082c400 02000001 00000e02 00040900 00980a42 28100000 40408840 00028022 00210000 00000420 0a082008 00020800 02100020 00202000 40020a01 00400500 08020a60 0100c000 00400014 00200000 80002201 04424200 80000000 00000203 00024002 e4020004 00010400 | 04010002 43000008 2000010a 0001030a 00081800 82800000 06000081 00000602 01040908 009a8840 08900000 40009840 8482802a 20a00080 13000401 00083408 00800600 22108020 006d2008 0a020a01 00000101 18000288 01008000 0c480c10 00600800 c0000000 00405040 80000000 00004302 8002400a 24060000 00000400 |