On Target GRM1_HUMAN 0.3233533/CHEMBL176068
For the given ligand HU-580, we have found in our database that, being scored 0.3233533, the most similar ligand is CHEMBL176068. Check out the elaboration below.
| HU-580 (Given Ligand) | CHEMBL176068 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)c(C(=O)OC)c2O | CCc1cc2cc(ccc2n3nnnc13)C(=O)[C@@H]4CC[C@@H](CC4)OC |
|
|
|
|
|
|
| 00000001 43000808 20000103 00010202 00010001 4082c400 02000001 00000e02 00040900 00980a42 28100000 40408840 00028022 00210000 00000420 0a082008 00020800 02100020 00202000 40020a01 00400500 08020a60 0100c000 00400014 00200000 80002201 04424200 80000000 00000203 00024002 e4020004 00010400 | 00014002 43004818 60004103 00010310 008c1001 0000400c 02002000 00200000 00400900 00080840 08100004 40009000 0400882a 00e00000 20000140 000c001c 00800000 02000804 02602400 00120201 40060100 08068228 21800000 80400014 00040400 80000040 08020000 00002000 00400202 00120002 c0060000 0c000400 |