On Target GRM3_HUMAN 0.35338345/CHEMBL2112634
For the given ligand HU-580, we have found in our database that, being scored 0.35338345, the most similar ligand is CHEMBL2112634. Check out the elaboration below.
| HU-580 (Given Ligand) | CHEMBL2112634 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)c(C(=O)OC)c2O | NC(CCc1cccc(c1)C(=O)O)([C@H]2C[C@@H]2C(=O)O)C(=O)O |
|
|
|
|
|
|
| 00000001 43000808 20000103 00010202 00010001 4082c400 02000001 00000e02 00040900 00980a42 28100000 40408840 00028022 00210000 00000420 0a082008 00020800 02100020 00202000 40020a01 00400500 08020a60 0100c000 00400014 00200000 80002201 04424200 80000000 00000203 00024002 e4020004 00010400 | 00030000 01000a00 00000102 00010600 00180001 00004000 00000000 00000000 00000900 000a0ac0 28100000 4001b000 04008038 03a00000 00000000 08080008 00000000 02000000 00402000 40000001 00000100 18020a20 03000000 00400014 00000000 80000000 00000000 00000000 00000002 0006000a c0020000 00400400 |