On Target CNR1_HUMAN 0.6960784/CHEMBL394305
For the given ligand CBDA, we have found in our database that, being scored 0.6960784, the most similar ligand is CHEMBL394305. Check out the elaboration below.
| CBDA (Given Ligand) | CHEMBL394305 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)c(C(=O)O)c2O | CCCCCCC1(CC1)c2cc(O)c([C@@H]3C=C(C)CCC3C(=C)C)c(O)c2 |
|
|
|
|
|
|
| 00000001 43000808 20000103 00010202 00010001 4082c000 02000001 00000e02 00040900 00980a42 28100000 40408840 00028022 00200000 00000420 08082008 00000000 02100020 00202000 40020a01 00400500 08020a60 0100c000 00400014 00200000 80000201 04424200 80000000 00000002 00024002 e4020000 00010400 | 00000001 43000008 20000102 00010202 00010000 40800000 02000001 00000602 00040900 00980842 08100000 40408840 00020002 01200000 00000400 00002008 00000000 02100020 00202000 00020a01 00000100 08000000 00008000 00400010 00200000 80000000 04404200 80000000 00000002 00024002 24020000 00010400 |