On Target AA1R_HUMAN 0.2857143/CHEMBL383134
For the given ligand HU-580, we have found in our database that, being scored 0.2857143, the most similar ligand is CHEMBL383134. Check out the elaboration below.
| HU-580 (Given Ligand) | CHEMBL383134 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)c(C(=O)OC)c2O | CC(NC(=O)c1cnc2nc(C)ccc2c1O)c3ccccc3 |
|
|
|
|
|
|
| 00000001 43000808 20000103 00010202 00010001 4082c400 02000001 00000e02 00040900 00980a42 28100000 40408840 00028022 00210000 00000420 0a082008 00020800 02100020 00202000 40020a01 00400500 08020a60 0100c000 00400014 00200000 80002201 04424200 80000000 00000203 00024002 e4020004 00010400 | 10000002 01808808 20004100 10010610 00041020 00024000 04004000 02001400 00000100 00180840 49200004 40008800 00008802 00d00000 00020440 020c200c 00022000 0200000c 00200000 40060200 c0000000 08068e28 20800000 8040011c 00040000 c0000000 08000040 80000000 00400104 00460003 c4040000 80240680 |