On Target OPRM_HUMAN 0.4652778/CHEMBL3948892
For the given ligand CBDA, we have found in our database that, being scored 0.4652778, the most similar ligand is CHEMBL3948892. Check out the elaboration below.
| CBDA (Given Ligand) | CHEMBL3948892 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)c(C(=O)O)c2O | NC(=O)c1ccc2C[C@@H]3[C@@H]4CCC(=C)C[C@]4(CCN3CC5CCC5)c2c1O |
|
|
|
|
|
|
| 00000001 43000808 20000103 00010202 00010001 4082c000 02000001 00000e02 00040900 00980a42 28100000 40408840 00028022 00200000 00000420 08082008 00000000 02100020 00202000 40020a01 00400500 08020a60 0100c000 00400014 00200000 80000201 04424200 80000000 00000002 00024002 e4020000 00010400 | 00000000 43000a08 20100102 40010600 00000021 c0020002 02000000 20001601 00000980 00180ac2 08300000 50818840 80008802 00200010 00000420 0a0c2008 00000200 02000000 02012400 00020201 00000100 18228610 01004000 81540014 00000000 80000001 0c000000 90000000 04000002 0006c00a a4060000 00012600 |