On Target CCR2_HUMAN 0.47008547/CHEMBL3754764
For the given ligand THC, we have found in our database that, being scored 0.47008547, the most similar ligand is CHEMBL3754764. Check out the elaboration below.
| THC (Given Ligand) | CHEMBL3754764 (Similar Ligand) |
|---|---|
| CCCCCc1cc(O)c2c(c1)OC(C)(C)[C@@H]3CC/C(C)=C\[C@@H]23 | C[C@H]1CC=C(C(=O)O)[C@@](C)(C1)c2ccc(C)c3ccccc23 |
|
|
|
|
|
|
| 04000001 c3000018 2000010a 80010302 00081000 c2800000 42000001 00000602 00040900 00980848 08100000 40008840 00820002 20a00080 11000401 00082008 00800000 22108020 00682000 00022a01 00000100 08000000 01008040 00400410 00200000 c0000000 00404000 80000000 00010302 00034002 24020000 00000400 | 00010000 01000000 00000102 00010200 00080000 00800000 00000081 08000402 01000900 00980840 08100000 40009800 04028008 00a00000 00000400 00080008 00000000 02100020 00612018 00000801 00000100 08000a88 01008040 00400010 00201800 80000400 00404000 80000000 00000002 00020002 24020000 00000400 |