On Target HRH4_HUMAN 0.41860464/CHEMBL1934062
For the given ligand THC, we have found in our database that, being scored 0.41860464, the most similar ligand is CHEMBL1934062. Check out the elaboration below.
| THC (Given Ligand) | CHEMBL1934062 (Similar Ligand) |
|---|---|
| CCCCCc1cc(O)c2c(c1)OC(C)(C)[C@@H]3CC/C(C)=C\[C@@H]23 | C[C@H]1CCCN1[C@H](CCCOc2ccccc2)c3ccc(cc3)c4ccc(CN5CCCCC5)cc4 |
|
|
|
|
|
|
| 04000001 c3000018 2000010a 80010302 00081000 c2800000 42000001 00000602 00040900 00980848 08100000 40008840 00820002 20a00080 11000401 00082008 00800000 22108020 00682000 00022a01 00000100 08000000 01008040 00400410 00200000 c0000000 00404000 80000000 00010302 00034002 24020000 00000400 | 04002000 01000008 2010010a 00010700 00181000 02000010 02000000 22001000 00000900 000808c0 08300000 50018800 80800802 00200000 11000401 00082008 00820000 02000000 04400000 10020201 00000100 18008000 11000000 00500010 00000000 c0000000 00000200 90000040 00004300 00060002 20040000 00002e00 |