On Target OPRX_HUMAN 0.44270834/CHEMBL3262362
For the given ligand THC, we have found in our database that, being scored 0.44270834, the most similar ligand is CHEMBL3262362. Check out the elaboration below.
| THC (Given Ligand) | CHEMBL3262362 (Similar Ligand) |
|---|---|
| CCCCCc1cc(O)c2c(c1)OC(C)(C)[C@@H]3CC/C(C)=C\[C@@H]23 | CC[C@](O)([C@H]1C[C@]23C=C[C@]1(OC)[C@@H]4Oc5c(O)ccc6C[C@H]2N(CC7CC7)CC[C@@]34c56)C(C)(C)C |
|
|
|
|
|
|
| 04000001 c3000018 2000010a 80010302 00081000 c2800000 42000001 00000602 00040900 00980848 08100000 40008840 00820002 20a00080 11000401 00082008 00800000 22108020 00682000 00022a01 00000100 08000000 01008040 00400410 00200000 c0000000 00404000 80000000 00010302 00034002 24020000 00000400 | 04001000 cb000208 20100d0a 80310700 00381061 c2000802 02081000 38000643 00002890 011818ca 48300300 51818040 00824002 21a00080 11240425 020ca018 08800200 22008060 17492012 0002a201 00000100 18200010 0500e040 89540410 00201000 c0002401 04524200 90800000 04000302 0007cc0a 24020000 00012f50 |