On Target CXCR1_HUMAN 0.25/CHEMBL220182
For the given ligand THC, we have found in our database that, being scored 0.25, the most similar ligand is CHEMBL220182. Check out the elaboration below.
| THC (Given Ligand) | CHEMBL220182 (Similar Ligand) |
|---|---|
| CCCCCc1cc(O)c2c(c1)OC(C)(C)[C@@H]3CC/C(C)=C\[C@@H]23 | CC[C@@H](NC1=C(Nc2cccc(C(=O)N(C)C)c2O)C(=O)C1=O)c3ccc4OCOc4c3 |
|
|
|
|
|
|
| 04000001 c3000018 2000010a 80010302 00081000 c2800000 42000001 00000602 00040900 00980848 08100000 40008840 00820002 20a00080 11000401 00082008 00800000 22108020 00682000 00022a01 00000100 08000000 01008040 00400410 00200000 c0000000 00404000 80000000 00010302 00034002 24020000 00000400 | 1040c002 46000808 6010010a 00012600 20011001 68022000 020400a0 22401500 05a00c40 001808d0 48380004 5042b000 0a00c802 20200000 81020441 1020e048 00050001 22008000 082b0210 20020201 48140b80 18128600 20000000 00448014 44041000 c0000080 20720010 b00c0580 21508302 20060003 a4045420 40012600 |