On Target GRM1_HUMAN 0.39166668/CHEMBL254372
For the given ligand THC, we have found in our database that, being scored 0.39166668, the most similar ligand is CHEMBL254372. Check out the elaboration below.
| THC (Given Ligand) | CHEMBL254372 (Similar Ligand) |
|---|---|
| CCCCCc1cc(O)c2c(c1)OC(C)(C)[C@@H]3CC/C(C)=C\[C@@H]23 | C=C1C[C@@H]2COC(=O)[C@]2(Cc3ccc4ccccc4c3)C1 |
|
|
|
|
|
|
| 04000001 c3000018 2000010a 80010302 00081000 c2800000 42000001 00000602 00040900 00980848 08100000 40008840 00820002 20a00080 11000401 00082008 00800000 22108020 00682000 00022a01 00000100 08000000 01008040 00400410 00200000 c0000000 00404000 80000000 00010302 00034002 24020000 00000400 | 00050040 81000008 00000102 80010300 00080000 00000000 00000000 00000400 00000800 00188848 08100000 40009000 04008008 00a00000 00080400 00081008 00820000 02000000 00402008 00000001 00000120 08000a08 01000040 00400010 00000c00 80002000 00000000 80000000 00000202 81020002 24020000 00000400 |