On Target NPBW1_HUMAN 0.21978022/CHEMBL1940539
For the given ligand CBD, we have found in our database that, being scored 0.21978022, the most similar ligand is CHEMBL1940539. Check out the elaboration below.
| CBD (Given Ligand) | CHEMBL1940539 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | COc1ccc(cc1)C2(CCC2)N[C@@H]3CC[C@@H]([C@H](C3)c4ccsc4)C(=O)N5CCN(CC5)c6nc7ccccc7[nH]6 |
|
|
|
|
|
|
| 00000001 43000008 20000102 00010202 00010000 40800000 02000001 00000602 00040900 00980842 08100000 40408840 00020002 00200000 00000400 00002008 00000000 02100020 00202000 00020a01 00000100 08000000 00008000 00400010 00200000 80000000 04404200 80000000 00000002 00024002 24020000 00010400 | 00010002 01002208 2010090a 85010600 00141040 00004000 02040000 22001008 00000900 200808c0 09308204 40019080 0400881a 00603011 01001441 001c000c 00000000 02004000 02202008 00a24601 40000100 7e8086b0 21800821 32700018 00004800 c4000000 00320000 90000004 0800031a 0046180b 60069000 00c12e80 |