On Target 5HT1F_HUMAN 0.23809524/CHEMBL497963
For the given ligand CBD, we have found in our database that, being scored 0.23809524, the most similar ligand is CHEMBL497963. Check out the elaboration below.
| CBD (Given Ligand) | CHEMBL497963 (Similar Ligand) |
|---|---|
| C=C(C)[C@@H]1CC/C(C)=C\[C@H]1c2c(O)cc(CCCCC)cc2O | Cc1ccc2c(OCCN3CCC(Cc4cccc(NS(=O)(=O)C)c4)CC3)cccc2n1 |
|
|
|
|
|
|
| 00000001 43000008 20000102 00010202 00010000 40800000 02000001 00000602 00040900 00980842 08100000 40408840 00020002 00200000 00000400 00002008 00000000 02100020 00202000 00020a01 00000100 08000000 00008000 00400010 00200000 80000000 04404200 80000000 00000002 00024002 24020000 00010400 | 04002002 01000008 2010410a 10310602 000410a0 00000000 06000000 20000008 00500800 000808c0 08302004 50018000 00800c02 00600801 810a1041 020e000c 10000000 02000004 00200000 00064201 40000100 18048808 32800000 80500010 00040080 80000000 00000040 1000000d 00400206 00060002 00040000 00250660 |