On Target MSHR_HUMAN 0.28292683/CHEMBL442537
For the given ligand THC, we have found in our database that, being scored 0.28292683, the most similar ligand is CHEMBL442537. Check out the elaboration below.
| THC (Given Ligand) | CHEMBL442537 (Similar Ligand) |
|---|---|
| CCCCCc1cc(O)c2c(c1)OC(C)(C)[C@@H]3CC/C(C)=C\[C@@H]23 | CCCCC(=O)NC1(CCc2c(C1)cccc2OCC)C(=O)N[C@H](Cc3ccccc3)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](Cc4c[nH]c5ccccc45)C(=O)NCC(=O)N |
|
|
|
|
|
|
| 04000001 c3000018 2000010a 80010302 00081000 c2800000 42000001 00000602 00040900 00980848 08100000 40008840 00820002 20a00080 11000401 00082008 00800000 22108020 00682000 00022a01 00000100 08000000 01008040 00400410 00200000 c0000000 00404000 80000000 00010302 00034002 24020000 00000400 | 04010002 43003a08 2010010a 45810e10 00041222 c0000002 03012000 2000020d 00700880 000908c2 08300014 4083b040 1e808812 20602889 81000061 020c200c 00000a00 02008000 00282408 00020201 40000100 38248628 20804003 93500418 00043800 c0000001 48010000 10000000 0c000302 0006c00b 20044200 00402620 |