On Target CXCR3_HUMAN 0.37654322/CHEMBL3697086
For the given ligand THC, we have found in our database that, being scored 0.37654322, the most similar ligand is CHEMBL3697086. Check out the elaboration below.
| THC (Given Ligand) | CHEMBL3697086 (Similar Ligand) |
|---|---|
| CCCCCc1cc(O)c2c(c1)OC(C)(C)[C@@H]3CC/C(C)=C\[C@@H]23 | COc1cc(CN(C[C@@H]2CC[C@H](CC2)C(=O)O)C(C)c3ccc4OCCc4c3)ccc1C5CC5CN6C(=O)CCC6=O |
|
|
|
|
|
|
| 04000001 c3000018 2000010a 80010302 00081000 c2800000 42000001 00000602 00040900 00980848 08100000 40008840 00820002 20a00080 11000401 00082008 00800000 22108020 00682000 00022a01 00000100 08000000 01008040 00400410 00200000 c0000000 00404000 80000000 00010302 00034002 24020000 00000400 | 04031000 45001208 2010010a 00010600 00081041 02000010 12040000 22001240 00100900 000808c0 08300000 40019840 8480880a 01a00000 01040401 000c2018 08002000 02000000 06482400 00020201 00020100 18048e10 01000000 00548418 00000000 c0000000 08320000 90800004 00000302 0006c00b 20060000 00802600 |