On Target NK1R_HUMAN 0.4090909/CHEMBL2112368
For the given ligand THC, we have found in our database that, being scored 0.4090909, the most similar ligand is CHEMBL2112368. Check out the elaboration below.
| THC (Given Ligand) | CHEMBL2112368 (Similar Ligand) |
|---|---|
| CCCCCc1cc(O)c2c(c1)OC(C)(C)[C@@H]3CC/C(C)=C\[C@@H]23 | COc1ccc(OC(F)(F)F)cc1[C@H]2COC3(CCCN[C@H]3c4ccccc4)C2 |
|
|
|
|
|
|
| 04000001 c3000018 2000010a 80010302 00081000 c2800000 42000001 00000602 00040900 00980848 08100000 40008840 00820002 20a00080 11000401 00082008 00800000 22108020 00682000 00022a01 00000100 08000000 01008040 00400410 00200000 c0000000 00404000 80000000 00010302 00034002 24020000 00000400 | 00000040 43000008 2011010a 80010700 001910d1 40000000 02000000 22009240 00100800 000808c0 08300000 50418140 00000802 21a00000 010c1409 00083008 18000000 02000000 04482000 00020201 00010120 18008010 13000048 00500410 10000400 c0000000 00080200 d0000001 02000302 00074002 20060000 02002e00 |