On Target HRH2_HUMAN 0.3857143/CHEMBL490632
For the given ligand THC, we have found in our database that, being scored 0.3857143, the most similar ligand is CHEMBL490632. Check out the elaboration below.
| THC (Given Ligand) | CHEMBL490632 (Similar Ligand) |
|---|---|
| CCCCCc1cc(O)c2c(c1)OC(C)(C)[C@@H]3CC/C(C)=C\[C@@H]23 | COc1c(OCCF)cccc1C(=O)C2CCN(CCc3ccc(C)cc3)CC2 |
|
|
|
|
|
|
| 04000001 c3000018 2000010a 80010302 00081000 c2800000 42000001 00000602 00040900 00980848 08100000 40008840 00820002 20a00080 11000401 00082008 00800000 22108020 00682000 00022a01 00000100 08000000 01008040 00400410 00200000 c0000000 00404000 80000000 00010302 00034002 24020000 00000400 | 06020000 43000808 2010010a 00210600 00001000 40020000 02000000 21000200 00100980 000808c0 08300000 50019840 0480c002 20200080 01004001 2208a008 00000000 02000000 00080400 00020201 00000100 18220200 00000000 81500414 00000000 c0000000 00000800 10000000 04000300 0006400a 80000000 00802600 |