On Target CCR4_HUMAN 0.32214764/CHEMBL1907216
For the given ligand THC, we have found in our database that, being scored 0.32214764, the most similar ligand is CHEMBL1907216. Check out the elaboration below.
| THC (Given Ligand) | CHEMBL1907216 (Similar Ligand) |
|---|---|
| CCCCCc1cc(O)c2c(c1)OC(C)(C)[C@@H]3CC/C(C)=C\[C@@H]23 | Brc1ccc(OCc2ccccc2)c(CNCC3CCCO3)c1 |
|
|
|
|
|
|
| 04000001 c3000018 2000010a 80010302 00081000 c2800000 42000001 00000602 00040900 00980848 08100000 40008840 00820002 20a00080 11000401 00082008 00800000 22108020 00682000 00022a01 00000100 08000000 01008040 00400410 00200000 c0000000 00404000 80000000 00010302 00034002 24020000 00000400 | 04004008 21008008 20100108 80010600 00081080 00004100 02000000 22001400 40000100 001008c0 08200000 c0018000 00800812 01010000 01081509 02082008 10000000 02008000 00400000 00020201 00000060 18008020 13008000 00d01010 10004400 c0002000 00420000 90000001 00000300 00060000 64040008 08000200 |