On Target ACM5_HUMAN 0.35664335/CHEMBL490
For the given ligand THC, we have found in our database that, being scored 0.35664335, the most similar ligand is CHEMBL490. Check out the elaboration below.
| THC (Given Ligand) | CHEMBL490 (Similar Ligand) |
|---|---|
| CCCCCc1cc(O)c2c(c1)OC(C)(C)[C@@H]3CC/C(C)=C\[C@@H]23 | Fc1ccc(cc1)[C@@H]2CCNC[C@H]2COc3ccc4OCOc4c3 |
|
|
|
|
|
|
| 04000001 c3000018 2000010a 80010302 00081000 c2800000 42000001 00000602 00040900 00980848 08100000 40008840 00820002 20a00080 11000401 00082008 00800000 22108020 00682000 00022a01 00000100 08000000 01008040 00400410 00200000 c0000000 00404000 80000000 00010302 00034002 24020000 00000400 | 04000001 01000208 20100108 02010700 00081000 02000010 42000000 20000000 00200800 000808c0 48300000 50018000 00804002 01001000 11000001 002ca008 00a00000 02000084 00c80000 00120a01 00040300 18000000 010000c0 00500010 40000001 80000000 00080000 30000001 01050200 0006800a 00000000 02012640 |