On Target NPBW1_HUMAN 0.15584415/CHEMBL2314317
For the given ligand a, we have found in our database that, being scored 0.15584415, the most similar ligand is CHEMBL2314317. Check out the elaboration below.
| a (Given Ligand) | CHEMBL2314317 (Similar Ligand) |
|---|---|
| Clc3cc(Cl)cc(c2ccc(c1cc(Cl)cc(Cl)c1)cc2)c3 | COc1ccc(OC2=C(Cl)C=NN(Cc3ccccc3c4ccccc4)C2=O)cc1 |
|
|
|
|
|
|
| 0000a000 00000000 00000100 00810200 00000000 00000020 04000000 00000000 00000100 00000840 00000000 40008800 02000004 00000400 80000000 00000000 00020000 02000000 04000000 10002000 00000000 08000100 10000000 00400000 00002000 80000000 00000000 00000040 00004000 00020000 00000000 00020000 | 00012004 00000609 60000108 10010600 00081078 00008008 42048000 00001000 16100000 900008c0 00002008 78858800 0600980e 02e00000 21040001 030d200c 08060008 02004028 04202110 40660000 00400000 3c018318 31800881 83700000 04107040 80008c00 00088000 00240040 04004200 00060c08 80040400 42c20000 |