On Target AA1R_HUMAN 0.46596858/CHEMBL3317571
For the given ligand chenyan1, we have found in our database that, being scored 0.46596858, the most similar ligand is CHEMBL3317571. Check out the elaboration below.
| chenyan1 (Given Ligand) | CHEMBL3317571 (Similar Ligand) |
|---|---|
| Cc1ccc4c(c1)[nH+]c(/C=C/c2cccc3cccnc23)n4c6cccc(OCCCN5CCN(C)CC5)c6 | Nc1nc(\C=C\c2ccccc2)nc3cn(nc13)c4ccccc4 |
|
|
|
|
|
|
| 04010002 80800a08 20104908 16050e10 00041064 06004000 a20080a0 08001408 00100104 000038c0 1120800c 40018000 00811802 0840a200 81060043 024c200c 08200408 02000004 00e00000 00420602 c0000000 38008038 a18000e1 83418010 00040001 c2000041 0840a040 40000200 0c418204 00460848 44040000 020002e0 | 0000000e 80800208 20081100 18090e20 01080060 0000c000 c4009080 08001c08 10100100 000118c0 01000004 40019000 00000802 00800000 800200c2 020c000c 10000400 02000008 01600000 00260400 c0000000 18018060 21800840 83410000 00100000 82000001 08412000 40000a00 0441000c 00460808 44040000 822405e0 |