On Target TAAR1_HUMAN 0.33516484/CHEMBL1549077
For the given ligand chenyan1, we have found in our database that, being scored 0.33516484, the most similar ligand is CHEMBL1549077. Check out the elaboration below.
| chenyan1 (Given Ligand) | CHEMBL1549077 (Similar Ligand) |
|---|---|
| Cc1ccc4c(c1)[nH+]c(/C=C/c2cccc3cccnc23)n4c6cccc(OCCCN5CCN(C)CC5)c6 | Cc1cccc(CCNCc2cc3ccc(C)cc3nc2O)c1 |
|
|
|
|
|
|
| 04010002 80800a08 20104908 16050e10 00041064 06004000 a20080a0 08001408 00100104 000038c0 1120800c 40018000 00811802 0840a200 81060043 024c200c 08200408 02000004 00e00000 00420602 c0000000 38008038 a18000e1 83418010 00040001 c2000041 0840a040 40000200 0c418204 00460848 44040000 020002e0 | 10000002 00008818 20104100 00010610 00041001 00000000 06004000 02001400 00000080 00180840 09200004 40008000 80000802 00400000 20000540 000c200c 00020000 02000004 00200000 00020200 40020000 18208808 20800000 81400010 00040000 c0000000 08000040 80000000 05400100 00060002 24040000 84000620 |