On Target OPRM_HUMAN 0.44334975/CHEMBL258781
For the given ligand chenyan1, we have found in our database that, being scored 0.44334975, the most similar ligand is CHEMBL258781. Check out the elaboration below.
| chenyan1 (Given Ligand) | CHEMBL258781 (Similar Ligand) |
|---|---|
| Cc1ccc4c(c1)[nH+]c(/C=C/c2cccc3cccnc23)n4c6cccc(OCCCN5CCN(C)CC5)c6 | COc1ccc(C)c(OC(CCN2CCC(CC2)N3C(=O)N(Cc4cccnc4)c5ccccc35)C(C)C)c1 |
|
|
|
|
|
|
| 04010002 80800a08 20104908 16050e10 00041064 06004000 a20080a0 08001408 00100104 000038c0 1120800c 40018000 00811802 0840a200 81060043 024c200c 08200408 02000004 00e00000 00420602 c0000000 38008038 a18000e1 83418010 00040001 c2000041 0840a040 40000200 0c418204 00460848 44040000 020002e0 | 04000003 01808608 20104108 00010710 000c1040 02004080 42044000 20001000 0c300100 800009e0 0d20800c 50018000 00809802 01c40000 013000c1 000c300c 00b00000 2200c004 00e08000 00020a01 c0000000 18008030 218000c1 81700010 00040001 c0000000 08020000 10040000 06410300 00460018 40080000 820026c0 |