On Target OPRK_HUMAN 0.47457626/CHEMBL2260849
For the given ligand test, we have found in our database that, being scored 0.47457626, the most similar ligand is CHEMBL2260849. Check out the elaboration below.
| test (Given Ligand) | CHEMBL2260849 (Similar Ligand) |
|---|---|
| CCCCCc1cccc(C)c1 | CN(C[C@@H]1C[C@@]1(CO)c2ccccc2)C34CC5CC(CC(C5)C3)C4 |
|
|
|
|
|
|
| 00000000 01000000 00000102 00010200 00000001 00000000 00000000 00000000 00000800 00080840 08100000 40008000 00000000 00200000 00000000 00080008 00000000 02000000 00002000 00000001 00000100 08000000 01000000 00400010 00000000 80000000 00000000 00000000 00000002 00020002 00000000 00000400 | 00000000 01000200 00100102 00010600 00180040 00000000 00000000 20000000 00100800 000808c0 08300000 40018000 00000002 01200000 00040000 000c0008 08000000 02000000 02402000 00000201 00000100 18000010 01000000 00500010 00000000 80000000 00000000 10000000 00000000 0006000a 00020000 00002e00 |