On Target ADRB2_HUMAN 0.40625/CHEMBL1800960
For the given ligand test, we have found in our database that, being scored 0.40625, the most similar ligand is CHEMBL1800960. Check out the elaboration below.
| test (Given Ligand) | CHEMBL1800960 (Similar Ligand) |
|---|---|
| CCCCCc1cccc(C)c1 | CC[C@@H](Cc1ccc(O)cc1)NC[C@H](O)c2cc(O)cc(O)c2 |
|
|
|
|
|
|
| 00000000 01000000 00000102 00010200 00000001 00000000 00000000 00000000 00000800 00080840 08100000 40008000 00000000 00200000 00000000 00080008 00000000 02000000 00002000 00000001 00000100 08000000 01000000 00400010 00000000 80000000 00000000 00000000 00000002 00020002 00000000 00000400 | 00000001 4b000008 20100102 00010600 00000080 80004000 02000000 00000000 00000980 00080840 08300000 40008000 00000002 00200000 00080000 00080008 10000000 02000000 00000000 00020a01 00000100 18200020 02000000 81400010 00000000 80000000 00120000 00000000 04000000 00060002 40000000 00002600 |