On Target 5HT2B_HUMAN 0.6/CHEMBL209254
For the given ligand CAR, we have found in our database that, being scored 0.6, the most similar ligand is CHEMBL209254. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL209254 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | Clc1cccc(N2CC[C@H]3CNC[C@H]32)c1 |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 0000c002 01000400 00100020 05000600 20000000 00002010 08000000 20000000 00200000 00000be0 00200004 40038800 02000006 00002001 00020040 00000000 00040000 00000000 08000000 00004201 60100000 38000120 20000001 02100012 00002000 00000000 00000000 10000080 08008000 00060010 00000000 00020200 |