On Target 5HT6R_HUMAN 0.7777778/CHEMBL4639203
For the given ligand CAR, we have found in our database that, being scored 0.7777778, the most similar ligand is CHEMBL4639203. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL4639203 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | O=C1[C@H]2[C@@H]3CC[C@@H](C3)[C@H]2C(=O)N1CCCCCCN1CCN(c2cccc(Cl)c2Cl)CC1 |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 0003c002 01001000 00100020 05000600 00000000 00000010 08000000 28000000 00000000 00000ac0 00200004 40019800 0600800e 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40120000 38040710 20000021 0211001a 00002000 00100400 00000000 10000080 08008002 01060001 00020000 00822200 |