On Target OPRD_HUMAN 0.464/CHEMBL401451
For the given ligand CAR, we have found in our database that, being scored 0.464, the most similar ligand is CHEMBL401451. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL401451 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | O=C1NCN(c2ccccc2)C12CCN(Cc1ccccc1Cl)CC2 |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 0002c006 01000400 00100120 00010e00 20000000 00000000 00000004 22003001 00200000 00000be0 00200004 5003b800 06009806 00002000 00020440 00000000 00040000 02402000 08000000 00000a01 60100900 38018700 20020000 00500012 00112000 c0000280 00000000 90000180 08008100 00060011 281c5000 00824200 |