On Target NPY1R_HUMAN 0.4716981/CHEMBL2046860
For the given ligand CAR, we have found in our database that, being scored 0.4716981, the most similar ligand is CHEMBL2046860. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL2046860 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | Cc1ccc([C@@]2(N3CCN(c4ccccc4)CC3)[C@H]3C[C@H](C)C[C@H]32)cc1 |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 00004002 01000000 00100122 04010600 00000000 00000000 00000000 22001000 00000900 00090ac0 08300004 40018800 80000802 01202000 00000440 00000000 00040000 02000000 0a002000 00000201 40100100 38008010 20000021 02500012 00000000 c0000000 00000000 90000080 08008102 01060002 00060000 00000600 |