On Target DRD5_HUMAN 0.45/CHEMBL238718
For the given ligand CAR, we have found in our database that, being scored 0.45, the most similar ligand is CHEMBL238718. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL238718 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | O=c1c2ccccc2ncn1CCCCN1CCN(c2ccc(Cl)cc2)CC1 |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 0000c002 00000000 00100020 04000600 000c0000 00004060 00000000 20000000 06200100 c0000ae0 0120000c 40038800 02009006 00e02000 000000c0 000c0004 00040000 00008000 08600000 00000201 c0100000 38000138 21800061 02300012 00002000 80000000 20080100 10040080 0800c000 00460000 40080000 02020280 |