On Target CXCR1_HUMAN 0.2826087/CHEMBL386072
For the given ligand CAR, we have found in our database that, being scored 0.2826087, the most similar ligand is CHEMBL386072. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL386072 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | CCC(CC)(NS(=O)(=O)c1c(Cl)ccc(N/C(=N/C#N)Nc2ccccc2Br)c1O)N1CCC(N)CC1 |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 0000c016 05808418 21100000 03b00e40 00080200 00020000 1a000000 61002001 00060000 004069c2 10202004 f0018c40 02005016 0000004b 802001d0 0000c208 00842a00 08000000 08400000 00026701 d0023102 18012100 20020400 185b0018 0210a000 00080004 e00a0800 1000048c 00008490 20060014 00180008 0e036268 |