On Target NPY5R_HUMAN 0.5185185/CHEMBL255352
For the given ligand CAR, we have found in our database that, being scored 0.5185185, the most similar ligand is CHEMBL255352. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL255352 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | CN(C(=O)NC1CCN(c2cccc(Cl)c2)CC1)C1CCN(S(C)(=O)=O)CC1 |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 0000c002 01001400 00100000 01300e00 20000000 00002000 08000004 00002000 00000000 004009e0 00202004 50018800 02009006 00000001 80c20040 00000000 00040000 00000000 08000040 00005203 60100100 18090500 20000000 10100018 02012000 00000008 00000000 1000008c 00008000 00060011 00100000 00030270 |