On Target ADRB1_HUMAN 0.61538464/CHEMBL1424807
For the given ligand CAR, we have found in our database that, being scored 0.61538464, the most similar ligand is CHEMBL1424807. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL1424807 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | Clc1cccc(N2CCNCC2)c1Cl |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 0000c002 00000000 00000020 05000600 00000000 00000000 08000000 08000000 00000000 00000a40 00200004 40008800 02000006 00002001 00000040 00000000 00040000 10000000 08000000 00004000 40100000 28000100 20000020 02010002 00002000 00100400 00000000 00000080 08008000 00060000 00000000 00020200 |