On Target ADA2B_HUMAN 0.40384614/CHEMBL51358
For the given ligand CAR, we have found in our database that, being scored 0.40384614, the most similar ligand is CHEMBL51358. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL51358 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | Clc1ccccc1NCC1=NCCN1 |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 0000c002 00000000 00224020 04000600 00000000 00000040 10000000 08020000 00000000 00000a43 10220014 40008800 02002006 00002108 00000040 00100000 00040820 10000000 08000000 00000000 40300000 28000100 a0000002 02010002 00022080 00000400 40000000 00000080 08008010 00068000 00800000 00020200 |