On Target CXCR3_HUMAN 0.5217391/CHEMBL583655
For the given ligand CAR, we have found in our database that, being scored 0.5217391, the most similar ligand is CHEMBL583655. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL583655 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | O=C(NCc1ccc(Cl)c(Cl)c1)c1ccc(N2CCN(C3CCN(Cc4ccc(Cl)cc4)CC3)CC2)c(Cl)c1 |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 0000c002 09800c00 00100120 84010600 00000000 00000000 04000000 2a001000 00000000 00000be8 00200004 50018800 02008846 0000a000 80000440 00000000 00042000 12000000 08000000 00000201 c0100000 38028700 20000021 0251001e 00002000 c0100400 00040000 90000080 08008100 00060811 a0040000 00020200 |