On Target GRM7_HUMAN 0.3888889/CHEMBL4575681
For the given ligand CAR, we have found in our database that, being scored 0.3888889, the most similar ligand is CHEMBL4575681. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL4575681 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | O=C(CNC(c1ccccc1)c1ccccc1)N1CCCc2ccccc21 |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 0000c002 00001200 00100120 04010600 20000000 00002040 00000000 23001000 00000800 00090ac0 08380024 4000a000 02008802 00102000 00020440 00040000 00248000 02000000 08000008 00000201 40100100 38048600 20002001 0240001a 00000000 e1000000 00000010 d0001080 08088180 0006000b 00044080 20000600 |