On Target 5HT5A_HUMAN 0.46728972/CHEMBL3764335
For the given ligand CAR, we have found in our database that, being scored 0.46728972, the most similar ligand is CHEMBL3764335. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL3764335 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | Cl.O=C(CCCCCN1CCN(c2ccccc2O)CC1)n1c2ccccc2c2ccccc21 |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 00014002 01000008 201000a0 04000700 00040000 00000000 02000000 20000000 00000000 00000ac0 00200004 40019000 0400880a 00402000 00000040 0004400c 00050000 00000000 08202000 00020201 40100000 38008618 20800021 82108012 00000000 00000000 20000000 10000080 08008000 00060001 00040a00 00020200 |