On Target CCR5_HUMAN 0.5350877/CHEMBL3398002
For the given ligand CAR, we have found in our database that, being scored 0.5350877, the most similar ligand is CHEMBL3398002. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL3398002 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | CC(=O)N1CCC(C(=O)N(CCCN2CCN(c3ccc(C#N)cc3)CC2C)c2ccc(C)c(Cl)c2)CC1 |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 0002c002 01001c00 00100120 05010600 20000020 00002000 08000000 20000000 00200000 00800be0 00280004 51039800 06008006 0010a001 00020040 00000000 00440000 02000000 08800000 00004201 60100000 380c0700 20002421 0250001a 00002000 80000200 00000000 10000080 08008000 00060411 00000000 00822200 |