On Target NPY2R_HUMAN 0.6/CHEMBL560914
For the given ligand CAR, we have found in our database that, being scored 0.6, the most similar ligand is CHEMBL560914. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL560914 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | CC1(C(=O)Nc2ccc(N3CCN(C(=O)c4ccccc4)CC3)c(Cl)c2)CCCCC1 |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 0001c002 01003800 00100120 05010600 20000000 00002000 08000000 0a001008 00000000 00010ac0 00280004 40019800 0600880e 00102001 00020440 00000000 00040000 12000000 0a002000 00004001 40100000 38068710 20002020 0251001e 00002000 c0000400 00000000 90000080 08008100 00060001 80060000 00020200 |