On Target V1AR_HUMAN 0.4379562/CHEMBL318392
For the given ligand CAR, we have found in our database that, being scored 0.4379562, the most similar ligand is CHEMBL318392. Check out the elaboration below.
| CAR (Given Ligand) | CHEMBL318392 (Similar Ligand) |
|---|---|
| CN(C)C(=O)N[C@@H]3CC[C@@H](CCN2CCN(c1cccc(Cl)c1Cl)CC2)CC3.Cl | O=C(Nc1ccc(C(=O)N2C[C@@H]3C4CCC(CC4)N3Cc3cc(Cl)ccc32)cc1)c1ccccc1Cl |
|
|
|
|
|
|
| 0000c002 01001000 00100020 05000e00 00000000 00000000 08000004 28002000 00000000 00000ac0 00200004 40018800 02009006 00002001 00000040 00000000 00040000 10000000 0a002000 00004201 40100100 38050510 20000021 0211001a 00012000 00100400 00000000 10000080 08008000 00060001 000a0000 00020200 | 0000c002 09003800 00100120 84010600 20000000 00102040 04000000 22001008 00000000 20010ac8 00280044 5001c800 02008806 0010a000 81020440 00000002 00240000 03000002 0a002000 00800201 40100810 38068710 20012001 0254001e 00002000 c0000200 00080010 90001080 08008100 00060001 a8060000 42022200 |