On Target 5HT7R_HUMAN 0.44594595/CHEMBL3581255
For the given ligand YJING, we have found in our database that, being scored 0.44594595, the most similar ligand is CHEMBL3581255. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL3581255 (Similar Ligand) |
|---|---|
| OCCNCc3ccc(OCc1ccc(F)cc1)c(OCc2ccc(F)cc2)c3 | COc1cc2c(C[C@@H]3N(C)CCc4cc(OC)c(OC)c2c34)cc1OCc5ccccc5 |
|
|
|
|
|
|
| 04000008 44000008 20100108 02210600 00001080 00004010 02040000 02001000 00000100 00000840 00200000 40008000 00804802 00011080 01000401 02088008 10000000 02000200 00480000 00120200 00000000 08008020 02000000 00c49000 00000000 c0002000 00220000 80000001 00000300 00068008 40040000 00000200 | 04002008 46000009 20100108 10210600 00021021 c8004002 02040000 02003001 00000980 10080840 08300000 40808000 00804892 20210080 21000401 0208a008 00020240 82001020 04480002 00621201 00020100 18308020 10405020 81c4d010 10800000 c0002081 10324000 80000041 04004300 1006040a 61441200 00002700 |