On Target 5HT6R_HUMAN 0.5/CHEMBL455332
For the given ligand YJING, we have found in our database that, being scored 0.5, the most similar ligand is CHEMBL455332. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL455332 (Similar Ligand) |
|---|---|
| OCCNCc3ccc(OCc1ccc(F)cc1)c(OCc2ccc(F)cc2)c3 | Cc1c(OCc2ccc(F)c(F)c2)cccc1C3CCNCC3 |
|
|
|
|
|
|
| 04000008 44000008 20100108 02210600 00001080 00004010 02040000 02001000 00000100 00000840 00200000 40008000 00804802 00011080 01000401 02088008 10000000 02000200 00480000 00120200 00000000 08008020 02000000 00c49000 00000000 c0002000 00220000 80000001 00000300 00068008 40040000 00000200 | 04000000 43400208 20100108 02010600 00001000 40004010 02000000 20000000 00000900 000828c0 08300000 50018000 00800002 20211080 01000001 020c2008 00001000 02008200 00080000 00120201 00000100 18000020 00004000 00c01010 00004000 80002003 00000000 10000001 00000300 0006800a 40000000 00000600 |