On Target AA3R_HUMAN 0.4/CHEMBL27673
For the given ligand YJING, we have found in our database that, being scored 0.4, the most similar ligand is CHEMBL27673. Check out the elaboration below.
| YJING (Given Ligand) | CHEMBL27673 (Similar Ligand) |
|---|---|
| OCCNCc3ccc(OCc1ccc(F)cc1)c(OCc2ccc(F)cc2)c3 | COc1ccccc1CNCCCCCCNCCCCCCCCNCCCCCCNCc2ccccc2OC |
|
|
|
|
|
|
| 04000008 44000008 20100108 02210600 00001080 00004010 02040000 02001000 00000100 00000840 00200000 40008000 00804802 00011080 01000401 02088008 10000000 02000200 00480000 00120200 00000000 08008020 02000000 00c49000 00000000 c0002000 00220000 80000001 00000300 00068008 40040000 00000200 | 00000000 01000008 20100108 00010600 00001000 00000100 02000000 22001400 00000000 001008c0 08200000 40018000 00000802 00000000 01000401 00002008 00000000 02000000 00002000 00020201 00000000 18008010 00000000 00500010 00000000 c0000000 00000000 90000000 00000300 00060000 24060000 00002200 |